Products 2374762-72-6

CAS 2374762-72-6 is the registry number for (S)-1-tert-Butyl 3-(chloromethyl) piperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate (CAS 2374762-72-6) is a chemical compound with the molecular formula C12H20ClNO4 and a molecular weight of 277.74 g/mol. IUPAC name: 1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate. InChIKey: JJTKPJOFDRDGDA-VIFPVBQESA-N.

Identity
Molecular formulaC12H20ClNO4
Molecular weight277.74 g/mol
IUPAC name1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate
InChIKeyJJTKPJOFDRDGDA-VIFPVBQESA-N
SMILESCC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)OCCl

Computed by PubChem (NCBI)