Products 2374762-72-6
CAS 2374762-72-6 is the registry number for (S)-1-tert-Butyl 3-(chloromethyl) piperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate (CAS 2374762-72-6) is a chemical compound with the molecular formula C12H20ClNO4 and a molecular weight of 277.74 g/mol. IUPAC name: 1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate. InChIKey: JJTKPJOFDRDGDA-VIFPVBQESA-N.
| Molecular formula | C12H20ClNO4 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-(chloromethyl) (3S)-piperidine-1,3-dicarboxylate |
| InChIKey | JJTKPJOFDRDGDA-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)OCCl |
Computed by PubChem (NCBI)