Products 2137463-66-0

CAS 2137463-66-0 is the registry number for 1-tert-Butyl 2-chloromethyl piperidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-(chloromethyl) piperidine-1,2-dicarboxylate (CAS 2137463-66-0) is a chemical compound with the molecular formula C12H20ClNO4 and a molecular weight of 277.74 g/mol. IUPAC name: 1-O-tert-butyl 2-O-(chloromethyl) piperidine-1,2-dicarboxylate. InChIKey: BTINZHKEPWFOBM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20ClNO4
Molecular weight277.74 g/mol
IUPAC name1-O-tert-butyl 2-O-(chloromethyl) piperidine-1,2-dicarboxylate
InChIKeyBTINZHKEPWFOBM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC1C(=O)OCCl

Computed by PubChem (NCBI)