CAS 1547742-68-6 appears in our catalog under these names: 1,2-Dimethyl-1H-indole-6-carboxylic acid 95%, 1,2-Dimethyl-1h-indole-6-carboxylic acid, 95%, 95%, 1,2-DIMETHYL-1H-INDOLE-6-CARBOXYLIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,2-dimethylindole-6-carboxylic acid (CAS 1547742-68-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1,2-dimethylindole-6-carboxylic acid. InChIKey: BHIWKNHMYSJDLB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1,2-dimethylindole-6-carboxylic acid |
| InChIKey | BHIWKNHMYSJDLB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)