Products 1547742-68-6

CAS 1547742-68-6 appears in our catalog under these names: 1,2-Dimethyl-1H-indole-6-carboxylic acid 95%, 1,2-Dimethyl-1h-indole-6-carboxylic acid, 95%, 95%, 1,2-DIMETHYL-1H-INDOLE-6-CARBOXYLIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1,2-dimethylindole-6-carboxylic acid (CAS 1547742-68-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1,2-dimethylindole-6-carboxylic acid. InChIKey: BHIWKNHMYSJDLB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC name1,2-dimethylindole-6-carboxylic acid
InChIKeyBHIWKNHMYSJDLB-UHFFFAOYSA-N
SMILESCC1=CC2=C(N1C)C=C(C=C2)C(=O)O

Computed by PubChem (NCBI)