Products 154801-74-8
CAS 154801-74-8 appears in our catalog under these names: Efavirenz Enantiomer, Efavirenz Impurity 18（Efavirenz Enantiomer）, ent-Efavirenz, >95% (HPLC), (R)-Efavirenz. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 25 mg.
(4R)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 154801-74-8) is a chemical compound with the molecular formula C14H9ClF3NO2 and a molecular weight of 315.67 g/mol. IUPAC name: (4R)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: XPOQHMRABVBWPR-CYBMUJFWSA-N.
| Molecular formula | C14H9ClF3NO2 |
|---|---|
| Molecular weight | 315.67 g/mol |
| IUPAC name | (4R)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | XPOQHMRABVBWPR-CYBMUJFWSA-N |
| SMILES | C1CC1C#C[C@@]2(C3=C(C=CC(=C3)Cl)NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)