CAS 1548534-80-0 appears in our catalog under these names: Methyl 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetate, 95%, Methyl 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetate (CAS 1548534-80-0) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: methyl 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetate. InChIKey: NJEPPXGBXWQZRB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO3 |
|---|---|
| Molecular weight | 279.51 g/mol |
| IUPAC name | methyl 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetate |
| InChIKey | NJEPPXGBXWQZRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)Cl)Br)O |
Computed by PubChem (NCBI)