Products 98590-32-0

CAS 98590-32-0 is the registry number for 2-(2-Bromo-4-chlorophenoxy)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-bromo-4-chlorophenoxy)propanoic acid (CAS 98590-32-0) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 2-(2-bromo-4-chlorophenoxy)propanoic acid. InChIKey: PDZQJUYZUQKLAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO3
Molecular weight279.51 g/mol
IUPAC name2-(2-bromo-4-chlorophenoxy)propanoic acid
InChIKeyPDZQJUYZUQKLAQ-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1)Cl)Br

Computed by PubChem (NCBI)