Products 2379321-62-5
CAS 2379321-62-5 appears in our catalog under these names: 6-Bromo-2-chloro-3-ethoxybenzoic acid, 95%, 6-Bromo-2-chloro-3-ethoxybenzoic acid, 98%, 6-Bromo-2-chloro-3-ethoxybenzoic acid, ≥95%, ≥95%, 6-Bromo-2-chloro-3-ethoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
6-bromo-2-chloro-3-ethoxybenzoic acid (CAS 2379321-62-5) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 6-bromo-2-chloro-3-ethoxybenzoic acid. InChIKey: SESDNENLASZFJU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO3 |
|---|---|
| Molecular weight | 279.51 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-ethoxybenzoic acid |
| InChIKey | SESDNENLASZFJU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Br)C(=O)O)Cl |
Computed by PubChem (NCBI)