Products 1935922-28-3

CAS 1935922-28-3 is the registry number for 2-(4-Bromo-3-chlorophenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-bromo-3-chlorophenoxy)propanoic acid (CAS 1935922-28-3) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenoxy)propanoic acid. InChIKey: IOXJBUIVMHMCSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO3
Molecular weight279.51 g/mol
IUPAC name2-(4-bromo-3-chlorophenoxy)propanoic acid
InChIKeyIOXJBUIVMHMCSJ-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=CC(=C(C=C1)Br)Cl

Computed by PubChem (NCBI)