Products 55171-61-4

CAS 55171-61-4 is the registry number for 2-Bromo-4,5-dimethoxybenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-bromo-4,5-dimethoxybenzoyl chloride (CAS 55171-61-4) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 2-bromo-4,5-dimethoxybenzoyl chloride. InChIKey: QADMMVWIMLEMOU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO3
Molecular weight279.51 g/mol
IUPAC name2-bromo-4,5-dimethoxybenzoyl chloride
InChIKeyQADMMVWIMLEMOU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)Cl)Br)OC

Computed by PubChem (NCBI)