CAS 155106-18-6 is the registry number for (S)-2-Phenylpiperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-phenylpiperidine;hydrochloride (CAS 155106-18-6) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (2S)-2-phenylpiperidine;hydrochloride. InChIKey: YNQTWZUWWFUKSN-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (2S)-2-phenylpiperidine;hydrochloride |
| InChIKey | YNQTWZUWWFUKSN-MERQFXBCSA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)