CAS 1551297-94-9 is the registry number for 2-(3-Chlorobenzyl)-2,3-dimethylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-chlorophenyl)methyl]-2,3-dimethylbutanoic acid (CAS 1551297-94-9) is a chemical compound with the molecular formula C13H17ClO2 and a molecular weight of 240.72 g/mol. IUPAC name: 2-[(3-chlorophenyl)methyl]-2,3-dimethylbutanoic acid. InChIKey: FSXRJUATYYXEDC-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO2 |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)methyl]-2,3-dimethylbutanoic acid |
| InChIKey | FSXRJUATYYXEDC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(CC1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)