Products 2635937-07-2
CAS 2635937-07-2 is the registry number for Tert-butyl 4-chloro-3,5-dimethylbenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 4-chloro-3,5-dimethylbenzoate (CAS 2635937-07-2) is a chemical compound with the molecular formula C13H17ClO2 and a molecular weight of 240.72 g/mol. IUPAC name: tert-butyl 4-chloro-3,5-dimethylbenzoate. InChIKey: VPEFIGKZYMVSGN-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO2 |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | tert-butyl 4-chloro-3,5-dimethylbenzoate |
| InChIKey | VPEFIGKZYMVSGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)