CAS 2245209-60-1 is the registry number for Methyl 2-(3-(2-Chloroethyl)phenyl)-2-methylpropanoate. Offered by: TRC. Available pack sizes: 250mg.
Methyl 2-[3-(2-chloroethyl)phenyl]-2-methylpropanoate (CAS 2245209-60-1) is a chemical compound with the molecular formula C13H17ClO2 and a molecular weight of 240.72 g/mol. IUPAC name: methyl 2-[3-(2-chloroethyl)phenyl]-2-methylpropanoate. InChIKey: IIOUOYLRZBAFEW-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO2 |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | methyl 2-[3-(2-chloroethyl)phenyl]-2-methylpropanoate |
| InChIKey | IIOUOYLRZBAFEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC(=C1)CCCl)C(=O)OC |
Computed by PubChem (NCBI)