CAS 7693-49-4 is the registry number for 2,6-Diisopropylphenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2,6-di(propan-2-yl)phenyl] carbonochloridate (CAS 7693-49-4) is a chemical compound with the molecular formula C13H17ClO2 and a molecular weight of 240.72 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl] carbonochloridate. InChIKey: OCXOOAMLBGDWQW-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO2 |
|---|---|
| Molecular weight | 240.72 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl] carbonochloridate |
| InChIKey | OCXOOAMLBGDWQW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OC(=O)Cl |
Computed by PubChem (NCBI)