Products 1551401-20-7
CAS 1551401-20-7 is the registry number for BMT-046091. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[(2S)-2-amino-4-methylpentoxy]-6H-benzo[c][2,7]naphthyridin-5-one (CAS 1551401-20-7) is a chemical compound with the molecular formula C18H21N3O2 and a molecular weight of 311.4 g/mol. IUPAC name: 8-[(2S)-2-amino-4-methylpentoxy]-6H-benzo[c][2,7]naphthyridin-5-one. InChIKey: ATCROYCGFZTPSQ-LBPRGKRZSA-N.
| Molecular formula | C18H21N3O2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 8-[(2S)-2-amino-4-methylpentoxy]-6H-benzo[c][2,7]naphthyridin-5-one |
| InChIKey | ATCROYCGFZTPSQ-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](COC1=CC2=C(C=C1)C3=C(C=NC=C3)C(=O)N2)N |
Computed by PubChem (NCBI)