Products 155172-79-5

CAS 155172-79-5 is the registry number for Acetylcysteine Impurity 37. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(E)-2-amino-3-phenylprop-2-enoic acid (CAS 155172-79-5) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-2-amino-3-phenylprop-2-enoic acid. InChIKey: YWIQQKOKNPPGDO-SOFGYWHQSA-N.

Identity
Molecular formulaC9H9NO2
Molecular weight163.17 g/mol
IUPAC name(E)-2-amino-3-phenylprop-2-enoic acid
InChIKeyYWIQQKOKNPPGDO-SOFGYWHQSA-N
SMILESC1=CC=C(C=C1)/C=C(\C(=O)O)/N

Computed by PubChem (NCBI)