Products 7060-39-1
CAS 7060-39-1 is the registry number for Dehydro Phenylalanine(cis/trans Mixture). Offered by: TRC. Available pack sizes: 100mg.
(Z)-2-amino-3-phenylprop-2-enoic acid (CAS 7060-39-1) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (Z)-2-amino-3-phenylprop-2-enoic acid. InChIKey: YWIQQKOKNPPGDO-VURMDHGXSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (Z)-2-amino-3-phenylprop-2-enoic acid |
| InChIKey | YWIQQKOKNPPGDO-VURMDHGXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)O)\N |
Computed by PubChem (NCBI)
Synonyms:
Phenyldehydroalanine, Dehydrophenylalanine, alpha-Aminocinnamate, 2,3-Didehydrophenylalanine, 2-Propenoic acid, 2-amino-3-phenyl-, (2Z)-2-amino-3-phenylprop-2-enoic acid, (Z)-2-amino-3-phenylprop-2-enoic acid, (z)-dehydrophenylalanine, 2-Amino-3-phenyl-2-Propenoicacid, 2-Amino-3-phenyl-2-propenoic Acid