CAS 1551876-08-4 appears in our catalog under these names: 1-((4-Bromophenyl)methyl)-4,5,6,7-tetrahydrobenzimidazole, 1-((4-Bromophenyl)methyl)-4,5,6,7-tetrahydro-1H-benzimidazole. Offered by: Biosynth, TRC. Available pack sizes: 100mg, 1g.
1-[(4-bromophenyl)methyl]-4,5,6,7-tetrahydrobenzimidazole (CAS 1551876-08-4) is a chemical compound with the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]-4,5,6,7-tetrahydrobenzimidazole. InChIKey: CWUVSOQUUJWXGJ-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2 |
|---|---|
| Molecular weight | 291.19 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]-4,5,6,7-tetrahydrobenzimidazole |
| InChIKey | CWUVSOQUUJWXGJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=CN2CC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)