CAS 1807752-96-0 is the registry number for 5-Bromo-N-mesitylpyridin-3-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-bromo-N-(2,4,6-trimethylphenyl)pyridin-3-amine (CAS 1807752-96-0) is a chemical compound with the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. IUPAC name: 5-bromo-N-(2,4,6-trimethylphenyl)pyridin-3-amine. InChIKey: PFOJSFCOUUDVSJ-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2 |
|---|---|
| Molecular weight | 291.19 g/mol |
| IUPAC name | 5-bromo-N-(2,4,6-trimethylphenyl)pyridin-3-amine |
| InChIKey | PFOJSFCOUUDVSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=CC(=CN=C2)Br)C |
Computed by PubChem (NCBI)