CAS 1807753-05-4 is the registry number for N-(3-Bromo-2,4,6-trimethylphenyl)-3-aminopyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-(3-bromo-2,4,6-trimethylphenyl)pyridin-3-amine (CAS 1807753-05-4) is a chemical compound with the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. IUPAC name: N-(3-bromo-2,4,6-trimethylphenyl)pyridin-3-amine. InChIKey: GKUOSEYJPFAFSI-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2 |
|---|---|
| Molecular weight | 291.19 g/mol |
| IUPAC name | N-(3-bromo-2,4,6-trimethylphenyl)pyridin-3-amine |
| InChIKey | GKUOSEYJPFAFSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1NC2=CN=CC=C2)C)Br)C |
Computed by PubChem (NCBI)