Products 2518116-15-7
CAS 2518116-15-7 is the registry number for Anastrozole Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(bromomethyl)-5-(1-cyanoethyl)phenyl]-2-methylpropanenitrile (CAS 2518116-15-7) is a chemical compound with the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. IUPAC name: 2-[3-(bromomethyl)-5-(1-cyanoethyl)phenyl]-2-methylpropanenitrile. InChIKey: DJQGNHFFZSNUKX-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2 |
|---|---|
| Molecular weight | 291.19 g/mol |
| IUPAC name | 2-[3-(bromomethyl)-5-(1-cyanoethyl)phenyl]-2-methylpropanenitrile |
| InChIKey | DJQGNHFFZSNUKX-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC(=C1)CBr)C(C)(C)C#N |
Computed by PubChem (NCBI)