Products 15524-46-6
CAS 15524-46-6 is the registry number for 1,3-Dichloro-5H,6H,7H-cyclopenta(C)pyridine-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,3-dichloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile (CAS 15524-46-6) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 1,3-dichloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile. InChIKey: ZCRYHTATGWYSMB-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 1,3-dichloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile |
| InChIKey | ZCRYHTATGWYSMB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=NC(=C2C#N)Cl)Cl |
Computed by PubChem (NCBI)