Products 1552559-94-0
CAS 1552559-94-0 is the registry number for 6-isobutoxy-2-methylnicotinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-6-(2-methylpropoxy)pyridine-3-carboxylic acid (CAS 1552559-94-0) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 2-methyl-6-(2-methylpropoxy)pyridine-3-carboxylic acid. InChIKey: ULXSUXXUONUCTM-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-methyl-6-(2-methylpropoxy)pyridine-3-carboxylic acid |
| InChIKey | ULXSUXXUONUCTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OCC(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-Isobutoxy-2-methylnicotinic acid