Products 1552563-71-9
CAS 1552563-71-9 is the registry number for Methyl 2-(2-(trifluoromethyl)phenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate (CAS 1552563-71-9) is a chemical compound with the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. IUPAC name: methyl 2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate. InChIKey: OTVNJQZNWGCCLB-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO2S |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | methyl 2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate |
| InChIKey | OTVNJQZNWGCCLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)