CAS 849066-52-0 is the registry number for 3-Amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid, 95% . Offered by: Thermo Scientific. Available pack sizes: 1g.
3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 849066-52-0) is a chemical compound with the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. IUPAC name: 3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: BPFFXVCOJJGNQU-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO2S |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid |
| InChIKey | BPFFXVCOJJGNQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=C2N)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)