Products 849066-52-0

CAS 849066-52-0 is the registry number for 3-Amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid, 95% . Offered by: Thermo Scientific. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 849066-52-0) is a chemical compound with the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. IUPAC name: 3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: BPFFXVCOJJGNQU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F3NO2S
Molecular weight287.26 g/mol
IUPAC name3-amino-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid
InChIKeyBPFFXVCOJJGNQU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(SC(=C2N)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)