Products 17969-63-0

CAS 17969-63-0 is the registry number for 2-(2-[4-(Trifluoromethyl)phenyl]-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid (CAS 17969-63-0) is a chemical compound with the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. IUPAC name: 2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: IOSJMGIPOGWVTB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F3NO2S
Molecular weight287.26 g/mol
IUPAC name2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid
InChIKeyIOSJMGIPOGWVTB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC(=CS2)CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)