CAS 886361-94-0 appears in our catalog under these names: 2-(2-[3-(Trifluoromethyl)phenyl]-1,3-thiazol-4-yl)acetic acid, 95%, 2-{2-(3-(Trifluoromethyl)phenyl)-1,3-thiazol-4-yl}acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid (CAS 886361-94-0) is a chemical compound with the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. IUPAC name: 2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: WYVJANJHKTZGQY-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO2S |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | WYVJANJHKTZGQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)