CAS 155266-51-6 is the registry number for 4,4'-(Pyridine-2,5-diyl)diphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol (CAS 155266-51-6) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol. InChIKey: GBBJAGDMZTWZBP-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol |
| InChIKey | GBBJAGDMZTWZBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)