Products 155266-51-6

CAS 155266-51-6 is the registry number for 4,4'-(Pyridine-2,5-diyl)diphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol (CAS 155266-51-6) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol. InChIKey: GBBJAGDMZTWZBP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO2
Molecular weight263.29 g/mol
IUPAC name4-[6-(4-hydroxyphenyl)-3-pyridinyl]phenol
InChIKeyGBBJAGDMZTWZBP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CN=C(C=C2)C3=CC=C(C=C3)O)O

Computed by PubChem (NCBI)