CAS 1553367-71-7 is the registry number for 5-Methyl-2-(4H-1,2,4-triazol-3-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-4-carboxylic acid (CAS 1553367-71-7) is a chemical compound with the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. IUPAC name: 5-methyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: QGHNSBDEZYGUPW-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2S |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 5-methyl-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | QGHNSBDEZYGUPW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=NC=NN2)C(=O)O |
Computed by PubChem (NCBI)