CAS 2988852-68-0 is the registry number for P3S, >98.0%(HPLC)(qNMR). Offered by: TCI. Available pack sizes: 50mg, 250mg.
3-(1,2,4-triazol-1-ylsulfonyl)pyridine (CAS 2988852-68-0) is a chemical compound with the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. IUPAC name: 3-(1,2,4-triazol-1-ylsulfonyl)pyridine. InChIKey: LBQFWDRVXUJAAR-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2S |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-ylsulfonyl)pyridine |
| InChIKey | LBQFWDRVXUJAAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)S(=O)(=O)N2C=NC=N2 |
Computed by PubChem (NCBI)