CAS 30710-21-5 is the registry number for 2-Hydrazino-6-nitro-1,3-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(6-nitro-1,3-benzothiazol-2-yl)hydrazine (CAS 30710-21-5) is a chemical compound with the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. IUPAC name: (6-nitro-1,3-benzothiazol-2-yl)hydrazine. InChIKey: HCIQJRCGPLSQLH-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2S |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | (6-nitro-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | HCIQJRCGPLSQLH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC(=N2)NN |
Computed by PubChem (NCBI)