CAS 869472-68-4 is the registry number for (5-Thien-3-yl-2h-tetrazol-2-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(5-thiophen-3-yltetrazol-2-yl)acetic acid (CAS 869472-68-4) is a chemical compound with the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. IUPAC name: 2-(5-thiophen-3-yltetrazol-2-yl)acetic acid. InChIKey: JUJVXKVUYGSNLK-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2S |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 2-(5-thiophen-3-yltetrazol-2-yl)acetic acid |
| InChIKey | JUJVXKVUYGSNLK-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=NN(N=N2)CC(=O)O |
Computed by PubChem (NCBI)