Products 1553989-99-3
CAS 1553989-99-3 is the registry number for 3-(4-Chlorophenyl)-2-fluoropropanoic acid. Offered by: TRC. Available pack sizes: 500mg.
3-(4-chlorophenyl)-2-fluoropropanoic acid (CAS 1553989-99-3) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-fluoropropanoic acid. InChIKey: TVUPTDHFWBPWSW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-fluoropropanoic acid |
| InChIKey | TVUPTDHFWBPWSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)F)Cl |
Computed by PubChem (NCBI)