CAS 15540-88-2 appears in our catalog under these names: 4,7-Dimethylisoindoline-1,3-dione, 98%, 4,7-Dimethyl-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,7-dimethylisoindole-1,3-dione (CAS 15540-88-2) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4,7-dimethylisoindole-1,3-dione. InChIKey: KQLNDLDZXKJABP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4,7-dimethylisoindole-1,3-dione |
| InChIKey | KQLNDLDZXKJABP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C)C(=O)NC2=O |
Computed by PubChem (NCBI)