Products 155412-73-0
CAS 155412-73-0 appears in our catalog under these names: 3-[(Dimethylamino)methyl]benzoic acid, 95%, 3-((Dimethylamino)methyl)benzoic acid hydrochloride, 3-((Dimethylamino)methyl)benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-[(dimethylamino)methyl]benzoic acid (CAS 155412-73-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 3-[(dimethylamino)methyl]benzoic acid. InChIKey: JOHOBHQNCZAHOU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]benzoic acid |
| InChIKey | JOHOBHQNCZAHOU-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=CC=C1)C(=O)O |
Computed by PubChem (NCBI)