Products 1554121-30-0

CAS 1554121-30-0 is the registry number for Methyl 3,4-diaminobutanoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3,4-diaminobutanoate;dihydrochloride (CAS 1554121-30-0) is a chemical compound with the molecular formula C5H14Cl2N2O2 and a molecular weight of 205.08 g/mol. IUPAC name: methyl 3,4-diaminobutanoate;dihydrochloride. InChIKey: IPSNUXDVOGPCHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H14Cl2N2O2
Molecular weight205.08 g/mol
IUPAC namemethyl 3,4-diaminobutanoate;dihydrochloride
InChIKeyIPSNUXDVOGPCHJ-UHFFFAOYSA-N
SMILESCOC(=O)CC(CN)N.Cl.Cl

Computed by PubChem (NCBI)