Products 2305202-73-5
CAS 2305202-73-5 is the registry number for (3S)-3,5-Diaminopentanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S)-3,5-diaminopentanoic acid;dihydrochloride (CAS 2305202-73-5) is a chemical compound with the molecular formula C5H14Cl2N2O2 and a molecular weight of 205.08 g/mol. IUPAC name: (3S)-3,5-diaminopentanoic acid;dihydrochloride. InChIKey: AXHKWJNCTJXSIL-FHNDMYTFSA-N.
| Molecular formula | C5H14Cl2N2O2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | (3S)-3,5-diaminopentanoic acid;dihydrochloride |
| InChIKey | AXHKWJNCTJXSIL-FHNDMYTFSA-N |
| SMILES | C(CN)[C@@H](CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)