Products 6211-16-1
CAS 6211-16-1 appears in our catalog under these names: L-Ornithine dihydrochloride, 98%, L-Ornithine dihydrochloride, L-Ornithine Dihydrochloride, >98.0%(N), L-Ornithine dihydrochloride, 98.00%, L-ORNITHINE DIHYDROCHLORIDE >= 99.0% (A&. Offered by: Combi-blocks, Biosynth, TCI, Chemat, Sigma-Aldrich. Available pack sizes: 5g, 1g, 25g, 50g, 100g, 250mg.
(2S)-2,5-diaminopentanoic acid;dihydrochloride (CAS 6211-16-1) is a chemical compound with the molecular formula C5H14Cl2N2O2 and a molecular weight of 205.08 g/mol. IUPAC name: (2S)-2,5-diaminopentanoic acid;dihydrochloride. InChIKey: HGBAVEGDXFHRQP-FHNDMYTFSA-N.
| Molecular formula | C5H14Cl2N2O2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | (2S)-2,5-diaminopentanoic acid;dihydrochloride |
| InChIKey | HGBAVEGDXFHRQP-FHNDMYTFSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-Ornithine, dihydrochloride, Ornithine dihydrochloride, Ornithine L-form HCl, Ornithine L-form dihydrochloride, L-Ornithine dihydrochloride, (S)-2,5-Diaminopentanoic acid dihydrochloride, H-Orn-OH.2HCl, (2S)-2,5-diaminopentanoic acid;dihydrochloride, (2S)-2,5-diaminopentanoic acid dihydrochloride, L-Ornithine--hydrogen chloride (1/2)