CAS 31697-39-9 appears in our catalog under these names: (S)-2-Amino-3-(dimethylamino)propanoic acid dihydrochloride, 97%, (S)-2-Amino-3-dimethylaminopropionic aciddihydrochloride, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg.
(2S)-2-amino-3-(dimethylamino)propanoic acid;dihydrochloride (CAS 31697-39-9) is a chemical compound with the molecular formula C5H14Cl2N2O2 and a molecular weight of 205.08 g/mol. IUPAC name: (2S)-2-amino-3-(dimethylamino)propanoic acid;dihydrochloride. InChIKey: OZWNGZATZQMSHU-FHNDMYTFSA-N.
| Molecular formula | C5H14Cl2N2O2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(dimethylamino)propanoic acid;dihydrochloride |
| InChIKey | OZWNGZATZQMSHU-FHNDMYTFSA-N |
| SMILES | CN(C)C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)