CAS 15542-38-8 appears in our catalog under these names: (2E,4E)-5-(4-(Dimethylamino)phenyl)penta-2,4-dienoic acid, 98%, (2E,4E)-5-(4-(Dimethylamino)phenyl)penta-2,4-dienoic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2E,4E)-5-[4-(dimethylamino)phenyl]penta-2,4-dienoic acid (CAS 15542-38-8) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: (2E,4E)-5-[4-(dimethylamino)phenyl]penta-2,4-dienoic acid. InChIKey: ZSAPOECVQGXVKJ-GGWOSOGESA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2E,4E)-5-[4-(dimethylamino)phenyl]penta-2,4-dienoic acid |
| InChIKey | ZSAPOECVQGXVKJ-GGWOSOGESA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C=C/C(=O)O |
Computed by PubChem (NCBI)