Products 1554514-74-7
CAS 1554514-74-7 appears in our catalog under these names: 2-(4-Bromo-3-methylphenyl)-1,3-dioxolane, 95%, 2-(4-Bromo-3-methylphenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-(4-bromo-3-methylphenyl)-1,3-dioxolane (CAS 1554514-74-7) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-1,3-dioxolane. InChIKey: WHJLISQDROHCSH-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-1,3-dioxolane |
| InChIKey | WHJLISQDROHCSH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2OCCO2)Br |
Computed by PubChem (NCBI)