CAS 1555334-81-0 is the registry number for 5-HT2A agonist 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(7-fluoronaphthalen-1-yl)ethanamine (CAS 1555334-81-0) is a chemical compound with the molecular formula C12H12FN and a molecular weight of 189.23 g/mol. IUPAC name: 2-(7-fluoronaphthalen-1-yl)ethanamine. InChIKey: AAXFKILFAHBDED-UHFFFAOYSA-N.
| Molecular formula | C12H12FN |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | 2-(7-fluoronaphthalen-1-yl)ethanamine |
| InChIKey | AAXFKILFAHBDED-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)F)C(=C1)CCN |
Computed by PubChem (NCBI)