Products 1556703-50-4
CAS 1556703-50-4 is the registry number for 6-Oxo-1-((oxolan-2-yl)methyl)-1,6-dihydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-oxo-1-(oxolan-2-ylmethyl)pyridazine-3-carboxylic acid (CAS 1556703-50-4) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 6-oxo-1-(oxolan-2-ylmethyl)pyridazine-3-carboxylic acid. InChIKey: BIUUDQZSSMHIEC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 6-oxo-1-(oxolan-2-ylmethyl)pyridazine-3-carboxylic acid |
| InChIKey | BIUUDQZSSMHIEC-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CN2C(=O)C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)