CAS 1557248-45-9 is the registry number for Ethyl 5,5-difluoro-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,5-difluoro-5a-methyl-1,4,4a,6-tetrahydrocyclopropa[f]indazole-3-carboxylate (CAS 1557248-45-9) is a chemical compound with the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. IUPAC name: ethyl 5,5-difluoro-5a-methyl-1,4,4a,6-tetrahydrocyclopropa[f]indazole-3-carboxylate. InChIKey: CNBAECFTPJIYAL-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O2 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | ethyl 5,5-difluoro-5a-methyl-1,4,4a,6-tetrahydrocyclopropa[f]indazole-3-carboxylate |
| InChIKey | CNBAECFTPJIYAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC2=C1CC3C(C2)(C3(F)F)C |
Computed by PubChem (NCBI)