CAS 2919992-17-7 is the registry number for Ethyl 5,6-diamino-4,7-difluoro-2,3-dihydro-1H-indene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,6-diamino-4,7-difluoro-2,3-dihydro-1H-indene-2-carboxylate (CAS 2919992-17-7) is a chemical compound with the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. IUPAC name: ethyl 5,6-diamino-4,7-difluoro-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: CDLZCFKUTMAASA-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O2 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | ethyl 5,6-diamino-4,7-difluoro-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | CDLZCFKUTMAASA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C1)C(=C(C(=C2F)N)N)F |
Computed by PubChem (NCBI)