Products 1557806-87-7
CAS 1557806-87-7 is the registry number for 1-Isopropyl-5-methyl-1H-indole-6-carboxylic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
5-methyl-1-propan-2-ylindole-6-carboxylic acid (CAS 1557806-87-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 5-methyl-1-propan-2-ylindole-6-carboxylic acid. InChIKey: QBADABGHIJYWHV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5-methyl-1-propan-2-ylindole-6-carboxylic acid |
| InChIKey | QBADABGHIJYWHV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)O)N(C=C2)C(C)C |
Computed by PubChem (NCBI)