CAS 1557921-62-6 appears in our catalog under these names: (6-Chloropyridin-2-yl)methanamine, 95%, (6–Chloropyridin–2–yl)methanamine dihydrochloride, (6-Chloropyridin-2-yl)methanamine dihydrochloride 95%, (6-Chloropyridin-2-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(6-chloro-2-pyridinyl)methanamine;dihydrochloride (CAS 1557921-62-6) is a chemical compound with the molecular formula C6H9Cl3N2 and a molecular weight of 215.5 g/mol. IUPAC name: (6-chloro-2-pyridinyl)methanamine;dihydrochloride. InChIKey: DQVXBCFIWAORLA-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl3N2 |
|---|---|
| Molecular weight | 215.5 g/mol |
| IUPAC name | (6-chloro-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | DQVXBCFIWAORLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)CN.Cl.Cl |
Computed by PubChem (NCBI)