CAS 59497-19-7 is the registry number for 3-Chloro-benzene-1,2-diamine dihydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-chlorobenzene-1,2-diamine;dihydrochloride (CAS 59497-19-7) is a chemical compound with the molecular formula C6H9Cl3N2 and a molecular weight of 215.5 g/mol. IUPAC name: 3-chlorobenzene-1,2-diamine;dihydrochloride. InChIKey: KWFXRLXRNYSJDB-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl3N2 |
|---|---|
| Molecular weight | 215.5 g/mol |
| IUPAC name | 3-chlorobenzene-1,2-diamine;dihydrochloride |
| InChIKey | KWFXRLXRNYSJDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)N.Cl.Cl |
Computed by PubChem (NCBI)