CAS 57803-83-5 appears in our catalog under these names: 4-Chlorobenzene-1,2-diamine dihydrochloride, 97%, 4-Chlorobenzene-1,2-diamine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg.
4-chlorobenzene-1,2-diamine;dihydrochloride (CAS 57803-83-5) is a chemical compound with the molecular formula C6H9Cl3N2 and a molecular weight of 215.5 g/mol. IUPAC name: 4-chlorobenzene-1,2-diamine;dihydrochloride. InChIKey: PAJLOJPTPBTVNC-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl3N2 |
|---|---|
| Molecular weight | 215.5 g/mol |
| IUPAC name | 4-chlorobenzene-1,2-diamine;dihydrochloride |
| InChIKey | PAJLOJPTPBTVNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)N.Cl.Cl |
Computed by PubChem (NCBI)