CAS 342816-31-3 appears in our catalog under these names: 2-Aminomethyl-3-chloro-pyridine dihydrochloride, (3-Chloro-pyridin-2-yl)-methylamine dihydrochloride, 95%, (3-Chloro-pyridin-2-yl)-methylamine DiHCl, 95%, 95%. Offered by: Biosynth, Combi-blocks, Chemat. Available pack sizes: 0,5g, 5g, 1g, 250mg, 100mg.
(3-chloro-2-pyridinyl)methanamine;dihydrochloride (CAS 342816-31-3) is a chemical compound with the molecular formula C6H9Cl3N2 and a molecular weight of 215.5 g/mol. IUPAC name: (3-chloro-2-pyridinyl)methanamine;dihydrochloride. InChIKey: OYXCTHVMOQFONQ-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl3N2 |
|---|---|
| Molecular weight | 215.5 g/mol |
| IUPAC name | (3-chloro-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | OYXCTHVMOQFONQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CN)Cl.Cl.Cl |
Computed by PubChem (NCBI)